C19H16ClFN2O4 — CID 108976462
1-N-(1,3-benzodioxol-5-ylmethyl)-1-N'-(3-chloro-4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976462) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-ylmethyl)-1-N'-(3-chloro-4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-1-N'-(3-chloro-4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976462 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-1-N'-(3-chloro-4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C1(C(=O)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H16ClFN2O4/c20-13-8-12(2-3-14(13)21)23-18(25)19(5-6-19)17(24)22-9-11-1-4-15-16(7-11)27-10-26-15/h1-4,7-8H,5-6,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | RLYLAUCYOLNKGF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|