C17H16ClN3O2 — CID 108976694
1-N'-(4-chlorophenyl)-1-N-(pyridin-2-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976694) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-N'-(4-chlorophenyl)-1-N-(pyridin-2-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-chlorophenyl)-1-N-(pyridin-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976694 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-N'-(4-chlorophenyl)-1-N-(pyridin-2-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1ccccn1)C1(C(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-12-4-6-13(7-5-12)21-16(23)17(8-9-17)15(22)20-11-14-3-1-2-10-19-14/h1-7,10H,8-9,11H2,(H,20,22)(H,21,23) |
| InChIKey | CBYCNNAHZCRUQR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|