C20H23N3O2 — CID 108976994
1-N-(pyridin-4-ylmethyl)-1-N'-(2,4,6-trimethylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976994) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-N-(pyridin-4-ylmethyl)-1-N'-(2,4,6-trimethylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(pyridin-4-ylmethyl)-1-N'-(2,4,6-trimethylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976994 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-N-(pyridin-4-ylmethyl)-1-N'-(2,4,6-trimethylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2(C(=O)NCc3ccncc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H23N3O2/c1-13-10-14(2)17(15(3)11-13)23-19(25)20(6-7-20)18(24)22-12-16-4-8-21-9-5-16/h4-5,8-11H,6-7,12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | RNKQKRJLYHQNPT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|