C24H28N2O2 — CID 108977267
1-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1-carboxamide (PubChem CID 108977267) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108977267 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(2-methyl-6-propan-2-ylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C1(C(=O)N2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C24H28N2O2/c1-16(2)20-10-6-7-17(3)21(20)25-22(27)24(12-13-24)23(28)26-14-11-18-8-4-5-9-19(18)15-26/h4-10,16H,11-15H2,1-3H3,(H,25,27) |
| InChIKey | UGYIKDVZVQXPEA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|