C23H28N2O3 — CID 108977761
1-N-[2-(4-methoxyphenyl)ethyl]-1-N'-(2-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108977761) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-N-[2-(4-methoxyphenyl)ethyl]-1-N'-(2-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[2-(4-methoxyphenyl)ethyl]-1-N'-(2-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108977761 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-N-[2-(4-methoxyphenyl)ethyl]-1-N'-(2-propan-2-ylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(CCNC(=O)C2(C(=O)Nc3ccccc3C(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-16(2)19-6-4-5-7-20(19)25-22(27)23(13-14-23)21(26)24-15-12-17-8-10-18(28-3)11-9-17/h4-11,16H,12-15H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | UTTDYLLGEWVHSS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|