C24H34N2O2 — CID 108979977
(4-benzylpiperidin-1-yl)-[1-(2-ethylpiperidine-1-carbonyl)cyclopropyl]methanone (PubChem CID 108979977) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-(2-ethylpiperidine-1-carbonyl)cyclopropyl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-(2-ethylpiperidine-1-carbonyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 108979977 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-(2-ethylpiperidine-1-carbonyl)cyclopropyl]methanone |
| SMILES | CCC1CCCCN1C(=O)C1(C(=O)N2CCC(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H34N2O2/c1-2-21-10-6-7-15-26(21)23(28)24(13-14-24)22(27)25-16-11-20(12-17-25)18-19-8-4-3-5-9-19/h3-5,8-9,20-21H,2,6-7,10-18H2,1H3 |
| InChIKey | LSOYLPZCKAXQGM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|