C25H30N2O2 — CID 108979992
1-(4-benzylpiperidine-1-carbonyl)-N-(2,3-dimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 108979992) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-(4-benzylpiperidine-1-carbonyl)-N-(2,3-dimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(4-benzylpiperidine-1-carbonyl)-N-(2,3-dimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108979992 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-(4-benzylpiperidine-1-carbonyl)-N-(2,3-dimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2(C(=O)N3CCC(Cc4ccccc4)CC3)CC2)c1C |
| InChI | InChI=1S/C25H30N2O2/c1-18-7-6-10-22(19(18)2)26-23(28)25(13-14-25)24(29)27-15-11-21(12-16-27)17-20-8-4-3-5-9-20/h3-10,21H,11-17H2,1-2H3,(H,26,28) |
| InChIKey | ICGUFMJIMFMSCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|