C46H55BrO5SSi2 — CID 10898194
[(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hexan-3-yl] acetate (PubChem CID 10898194) has the molecular formula C46H55BrO5SSi2 and a molecular weight of 858.08 g/mol. Its IUPAC name is [(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hexan-3-yl] acetate.
| Compound Name | [(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hexan-3-yl] acetate |
|---|---|
| PubChem CID | 10898194 |
| Molecular Formula | C46H55BrO5SSi2 |
| Molecular Weight | 858.08 g/mol |
| Exact Mass | 856.25 |
| IUPAC Name | [(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-1,5-bis[[tert-butyl(diphenyl)silyl]oxy]hexan-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C[C@@H](CS(=[18O])c1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](Br)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C46H55BrO5SSi2/c1-36(48)51-44(43(47)34-50-54(45(2,3)4,39-25-15-9-16-26-39)40-27-17-10-18-28-40)33-37(35-53(49)38-23-13-8-14-24-38)52-55(46(5,6)7,41-29-19-11-20-30-41)42-31-21-12-22-32-42/h8-32,37,43-44H,33-35H2,1-7H3/t37-,43-,44+,53?/m0/s1/i49+2 |
| InChIKey | GXEXHDICFFPCHG-JPCFRYADSA-N |
| XLogP | 8.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.08 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|