C20H21ClN2O3 — CID 108982689
1-N'-(5-chloro-2-methylphenyl)-1-N-(2-ethoxyphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108982689) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 1-N'-(5-chloro-2-methylphenyl)-1-N-(2-ethoxyphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(5-chloro-2-methylphenyl)-1-N-(2-ethoxyphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982689 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-N'-(5-chloro-2-methylphenyl)-1-N-(2-ethoxyphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1(C(=O)Nc2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-3-26-17-7-5-4-6-15(17)22-18(24)20(10-11-20)19(25)23-16-12-14(21)9-8-13(16)2/h4-9,12H,3,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | AAXSMHPHCCGSBA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|