C18H16ClFN2O2 — CID 108982710
1-N'-(5-chloro-2-methylphenyl)-1-N-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108982710) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is 1-N'-(5-chloro-2-methylphenyl)-1-N-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(5-chloro-2-methylphenyl)-1-N-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108982710 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-N'-(5-chloro-2-methylphenyl)-1-N-(3-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H16ClFN2O2/c1-11-5-6-12(19)9-15(11)22-17(24)18(7-8-18)16(23)21-14-4-2-3-13(20)10-14/h2-6,9-10H,7-8H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KOEUVLOMKIYNON-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|