C15H19ClN2O2 — CID 108984045
N-[2-(3-chlorophenyl)ethyl]-N'-cyclopentyloxamide (PubChem CID 108984045) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-cyclopentyloxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-cyclopentyloxamide |
|---|---|
| PubChem CID | 108984045 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-cyclopentyloxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-12-5-3-4-11(10-12)8-9-17-14(19)15(20)18-13-6-1-2-7-13/h3-5,10,13H,1-2,6-9H2,(H,17,19)(H,18,20) |
| InChIKey | MUSSNZDBNGHRPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|