About (2R)-2-hydroxybutanamide
(2R)-2-hydroxybutanamide (PubChem CID 10898665) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is (2R)-2-hydroxybutanamide.
Molecular Properties
| Compound Name | (2R)-2-hydroxybutanamide |
| PubChem CID | 10898665 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | (2R)-2-hydroxybutanamide |
| SMILES | CC[C@@H](O)C(N)=O |
| InChI | InChI=1S/C4H9NO2/c1-2-3(6)4(5)7/h3,6H,2H2,1H3,(H2,5,7)/t3-/m1/s1 |
| InChIKey | UUXHICUVBOTXQS-GSVOUGTGSA-N |
| XLogP | -0.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxybutanamide?
The IUPAC name of (2R)-2-hydroxybutanamide (CID 10898665) is (2R)-2-hydroxybutanamide.
What is the SMILES notation for (2R)-2-hydroxybutanamide?
The canonical SMILES for (2R)-2-hydroxybutanamide is CC[C@@H](O)C(N)=O.
What is the InChIKey of (2R)-2-hydroxybutanamide?
The InChIKey is UUXHICUVBOTXQS-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H9NO2/c1-2-3(6)4(5)7/h3,6H,2H2,1H3,(H2,5,7)/t3-/m1/s1.
What are the key properties of (2R)-2-hydroxybutanamide?
(2R)-2-hydroxybutanamide has a molecular weight of 103.12 g/mol, XLogP of -0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxybutanamide is sourced from PubChem (CID 10898665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).