methyl 2-methyl-3-oxoprop-2-enoate

C5H6O3 — CID 10898683

IUPACmethyl 2-methyl-3-oxoprop-2-enoate
SMILESCOC(=O)C(C)=C=O
InChIInChI=1S/C5H6O3/c1-4(3-6)5(7)8-2/h1-2H3
InChIKeyRHWVFTULIFCENJ-UHFFFAOYSA-N
MW114.10 g/mol
LogP-0.06
Rot. Bonds1

About methyl 2-methyl-3-oxoprop-2-enoate

methyl 2-methyl-3-oxoprop-2-enoate (PubChem CID 10898683) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is methyl 2-methyl-3-oxoprop-2-enoate.

Molecular Properties

Compound Namemethyl 2-methyl-3-oxoprop-2-enoate
PubChem CID10898683
Molecular FormulaC5H6O3
Molecular Weight114.10 g/mol
Exact Mass114.03
IUPAC Namemethyl 2-methyl-3-oxoprop-2-enoate
SMILESCOC(=O)C(C)=C=O
InChIInChI=1S/C5H6O3/c1-4(3-6)5(7)8-2/h1-2H3
InChIKeyRHWVFTULIFCENJ-UHFFFAOYSA-N
XLogP-0.06
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.10
LogP ≤ 5-0.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-methyl-3-oxoprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-3-oxoprop-2-enoate?
The IUPAC name of methyl 2-methyl-3-oxoprop-2-enoate (CID 10898683) is methyl 2-methyl-3-oxoprop-2-enoate.
What is the SMILES notation for methyl 2-methyl-3-oxoprop-2-enoate?
The canonical SMILES for methyl 2-methyl-3-oxoprop-2-enoate is COC(=O)C(C)=C=O.
What is the InChIKey of methyl 2-methyl-3-oxoprop-2-enoate?
The InChIKey is RHWVFTULIFCENJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c1-4(3-6)5(7)8-2/h1-2H3.
What are the key properties of methyl 2-methyl-3-oxoprop-2-enoate?
methyl 2-methyl-3-oxoprop-2-enoate has a molecular weight of 114.10 g/mol, XLogP of -0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-oxoprop-2-enoate is sourced from PubChem (CID 10898683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).