C17H17BrN2O2 — CID 108986891
N'-(3-bromo-4-methylphenyl)-N-(4-ethylphenyl)oxamide (PubChem CID 108986891) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is N'-(3-bromo-4-methylphenyl)-N-(4-ethylphenyl)oxamide.
| Compound Name | N'-(3-bromo-4-methylphenyl)-N-(4-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 108986891 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N'-(3-bromo-4-methylphenyl)-N-(4-ethylphenyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)Nc2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C17H17BrN2O2/c1-3-12-5-8-13(9-6-12)19-16(21)17(22)20-14-7-4-11(2)15(18)10-14/h4-10H,3H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VWMZGPWYOBMCKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|