About 2,3,5-trimethylcyclohexa-2,5-dien-1-one
2,3,5-trimethylcyclohexa-2,5-dien-1-one (PubChem CID 10898771) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 2,3,5-trimethylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 2,3,5-trimethylcyclohexa-2,5-dien-1-one |
| PubChem CID | 10898771 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 2,3,5-trimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C(C)=C(C)C1 |
| InChI | InChI=1S/C9H12O/c1-6-4-7(2)8(3)9(10)5-6/h5H,4H2,1-3H3 |
| InChIKey | MKCYLUXAUWXEJC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,5-trimethylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethylcyclohexa-2,5-dien-1-one?
The IUPAC name of 2,3,5-trimethylcyclohexa-2,5-dien-1-one (CID 10898771) is 2,3,5-trimethylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 2,3,5-trimethylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 2,3,5-trimethylcyclohexa-2,5-dien-1-one is CC1=CC(=O)C(C)=C(C)C1.
What is the InChIKey of 2,3,5-trimethylcyclohexa-2,5-dien-1-one?
The InChIKey is MKCYLUXAUWXEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-6-4-7(2)8(3)9(10)5-6/h5H,4H2,1-3H3.
What are the key properties of 2,3,5-trimethylcyclohexa-2,5-dien-1-one?
2,3,5-trimethylcyclohexa-2,5-dien-1-one has a molecular weight of 136.19 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 10898771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).