About non-8-en-1-yn-3-ol
non-8-en-1-yn-3-ol (PubChem CID 10898785) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is non-8-en-1-yn-3-ol.
Molecular Properties
| Compound Name | non-8-en-1-yn-3-ol |
| PubChem CID | 10898785 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | non-8-en-1-yn-3-ol |
| SMILES | C#CC(O)CCCCC=C |
| InChI | InChI=1S/C9H14O/c1-3-5-6-7-8-9(10)4-2/h2-3,9-10H,1,5-8H2 |
| InChIKey | IROVUXZYWOFLHX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze non-8-en-1-yn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-8-en-1-yn-3-ol?
The IUPAC name of non-8-en-1-yn-3-ol (CID 10898785) is non-8-en-1-yn-3-ol.
What is the SMILES notation for non-8-en-1-yn-3-ol?
The canonical SMILES for non-8-en-1-yn-3-ol is C#CC(O)CCCCC=C.
What is the InChIKey of non-8-en-1-yn-3-ol?
The InChIKey is IROVUXZYWOFLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-3-5-6-7-8-9(10)4-2/h2-3,9-10H,1,5-8H2.
What are the key properties of non-8-en-1-yn-3-ol?
non-8-en-1-yn-3-ol has a molecular weight of 138.21 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for non-8-en-1-yn-3-ol is sourced from PubChem (CID 10898785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).