C13H20N2O2 — CID 108988118
1-benzyl-3-(3-methoxypropyl)-1-methylurea (PubChem CID 108988118) has the molecular formula C13H20N2O2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-benzyl-3-(3-methoxypropyl)-1-methylurea.
| Compound Name | 1-benzyl-3-(3-methoxypropyl)-1-methylurea |
|---|---|
| PubChem CID | 108988118 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-benzyl-3-(3-methoxypropyl)-1-methylurea |
| SMILES | COCCCNC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2O2/c1-15(11-12-7-4-3-5-8-12)13(16)14-9-6-10-17-2/h3-5,7-8H,6,9-11H2,1-2H3,(H,14,16) |
| InChIKey | HYDLHUSVJXSNDW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|