C10H12O — CID 10898854
(1R,7S)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 10898854) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is (1R,7S)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1R,7S)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 10898854 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (1R,7S)-tricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | OC1C=CC2C1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C10H12O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-4,6-11H,5H2/t6-,7+,8?,9?,10?/m1/s1 |
| InChIKey | SIRXYHBXRXZGJQ-LXWZSJDBSA-N |
| XLogP | 1.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|