About (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol
(2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol (PubChem CID 10898868) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol.
Molecular Properties
| Compound Name | (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol |
| PubChem CID | 10898868 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol |
| SMILES | CC(C)=CC#C/C(C)=C\CO |
| InChI | InChI=1S/C10H14O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,8H2,1-3H3/b10-7- |
| InChIKey | FYQGSDXVCUALKV-YFHOEESVSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol?
The IUPAC name of (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol (CID 10898868) is (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol.
What is the SMILES notation for (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol?
The canonical SMILES for (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol is CC(C)=CC#C/C(C)=C\CO.
What is the InChIKey of (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol?
The InChIKey is FYQGSDXVCUALKV-YFHOEESVSA-N. The full InChI is InChI=1S/C10H14O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,8H2,1-3H3/b10-7-.
What are the key properties of (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol?
(2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol has a molecular weight of 150.22 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,7-dimethylocta-2,6-dien-4-yn-1-ol is sourced from PubChem (CID 10898868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).