C8H16N2O — CID 10898946
(3S)-3-amino-7,7-dimethylazepan-2-one (PubChem CID 10898946) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (3S)-3-amino-7,7-dimethylazepan-2-one.
| Compound Name | (3S)-3-amino-7,7-dimethylazepan-2-one |
|---|---|
| PubChem CID | 10898946 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3S)-3-amino-7,7-dimethylazepan-2-one |
| SMILES | CC1(C)CCC[C@H](N)C(=O)N1 |
| InChI | InChI=1S/C8H16N2O/c1-8(2)5-3-4-6(9)7(11)10-8/h6H,3-5,9H2,1-2H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | NNOPYGPRYZHBRN-LURJTMIESA-N |
| XLogP | 0.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |