About 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone
1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone (PubChem CID 10899048) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone.
Analyze 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone?
The IUPAC name of 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone (CID 10899048) is 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone.
What is the SMILES notation for 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone?
The canonical SMILES for 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone is CC(=O)C1=C2CCCCC2OC1.
What is the InChIKey of 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone?
The InChIKey is HWPRXTJOXHVIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-7(11)9-6-12-10-5-3-2-4-8(9)10/h10H,2-6H2,1H3.
What are the key properties of 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone?
1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone has a molecular weight of 166.22 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4,5,6,7,7a-hexahydro-1-benzofuran-3-yl)ethanone is sourced from PubChem (CID 10899048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).