About (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one
(2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one (PubChem CID 10899137) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one |
| PubChem CID | 10899137 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one |
| SMILES | COCO[C@H]1C=CC(=O)O[C@H]1C |
| InChI | InChI=1S/C8H12O4/c1-6-7(11-5-10-2)3-4-8(9)12-6/h3-4,6-7H,5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | CSHWETKJQZNDDC-BQBZGAKWSA-N |
| XLogP | 0.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one?
The IUPAC name of (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one (CID 10899137) is (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one?
The canonical SMILES for (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one is COCO[C@H]1C=CC(=O)O[C@H]1C.
What is the InChIKey of (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one?
The InChIKey is CSHWETKJQZNDDC-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H12O4/c1-6-7(11-5-10-2)3-4-8(9)12-6/h3-4,6-7H,5H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one?
(2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one has a molecular weight of 172.18 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-(methoxymethoxy)-2-methyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 10899137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).