C12H21N — CID 10899258
2-(4,4-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylethanamine (PubChem CID 10899258) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(4,4-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 10899258 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2-(4,4-dimethylcyclohexa-2,5-dien-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1C=CC(C)(C)C=C1 |
| InChI | InChI=1S/C12H21N/c1-12(2)8-5-11(6-9-12)7-10-13(3)4/h5-6,8-9,11H,7,10H2,1-4H3 |
| InChIKey | MWIOFZYYHVMUJL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|