About (2E)-2-bromo-6-methylhepta-2,5-diene
(2E)-2-bromo-6-methylhepta-2,5-diene (PubChem CID 10899422) has the molecular formula C8H13Br
and a molecular weight of 189.10 g/mol. Its IUPAC name is (2E)-2-bromo-6-methylhepta-2,5-diene.
Molecular Properties
| Compound Name | (2E)-2-bromo-6-methylhepta-2,5-diene |
| PubChem CID | 10899422 |
| Molecular Formula | C8H13Br |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | (2E)-2-bromo-6-methylhepta-2,5-diene |
| SMILES | CC(C)=CC/C=C(\C)Br |
| InChI | InChI=1S/C8H13Br/c1-7(2)5-4-6-8(3)9/h5-6H,4H2,1-3H3/b8-6+ |
| InChIKey | CDNSNKIDCFYBGJ-SOFGYWHQSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-bromo-6-methylhepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-bromo-6-methylhepta-2,5-diene?
The IUPAC name of (2E)-2-bromo-6-methylhepta-2,5-diene (CID 10899422) is (2E)-2-bromo-6-methylhepta-2,5-diene.
What is the SMILES notation for (2E)-2-bromo-6-methylhepta-2,5-diene?
The canonical SMILES for (2E)-2-bromo-6-methylhepta-2,5-diene is CC(C)=CC/C=C(\C)Br.
What is the InChIKey of (2E)-2-bromo-6-methylhepta-2,5-diene?
The InChIKey is CDNSNKIDCFYBGJ-SOFGYWHQSA-N. The full InChI is InChI=1S/C8H13Br/c1-7(2)5-4-6-8(3)9/h5-6H,4H2,1-3H3/b8-6+.
What are the key properties of (2E)-2-bromo-6-methylhepta-2,5-diene?
(2E)-2-bromo-6-methylhepta-2,5-diene has a molecular weight of 189.10 g/mol, XLogP of 3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-bromo-6-methylhepta-2,5-diene is sourced from PubChem (CID 10899422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).