C12H16O2 — CID 10899472
8,8-dimethylspiro[4.5]dec-2-ene-6,10-dione (PubChem CID 10899472) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 8,8-dimethylspiro[4.5]dec-2-ene-6,10-dione.
| Compound Name | 8,8-dimethylspiro[4.5]dec-2-ene-6,10-dione |
|---|---|
| PubChem CID | 10899472 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 8,8-dimethylspiro[4.5]dec-2-ene-6,10-dione |
| SMILES | CC1(C)CC(=O)C2(CC=CC2)C(=O)C1 |
| InChI | InChI=1S/C12H16O2/c1-11(2)7-9(13)12(10(14)8-11)5-3-4-6-12/h3-4H,5-8H2,1-2H3 |
| InChIKey | HMWOWLABXDOENQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|