About 3-pyridin-2-yltriazolo[1,5-a]pyridine
3-pyridin-2-yltriazolo[1,5-a]pyridine (PubChem CID 10899554) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-pyridin-2-yltriazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 3-pyridin-2-yltriazolo[1,5-a]pyridine |
| PubChem CID | 10899554 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-pyridin-2-yltriazolo[1,5-a]pyridine |
| SMILES | c1ccc(-c2nnn3ccccc23)nc1 |
| InChI | InChI=1S/C11H8N4/c1-3-7-12-9(5-1)11-10-6-2-4-8-15(10)14-13-11/h1-8H |
| InChIKey | UOTWLIQIOIIOSS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-2-yltriazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-yltriazolo[1,5-a]pyridine?
The IUPAC name of 3-pyridin-2-yltriazolo[1,5-a]pyridine (CID 10899554) is 3-pyridin-2-yltriazolo[1,5-a]pyridine.
What is the SMILES notation for 3-pyridin-2-yltriazolo[1,5-a]pyridine?
The canonical SMILES for 3-pyridin-2-yltriazolo[1,5-a]pyridine is c1ccc(-c2nnn3ccccc23)nc1.
What is the InChIKey of 3-pyridin-2-yltriazolo[1,5-a]pyridine?
The InChIKey is UOTWLIQIOIIOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c1-3-7-12-9(5-1)11-10-6-2-4-8-15(10)14-13-11/h1-8H.
What are the key properties of 3-pyridin-2-yltriazolo[1,5-a]pyridine?
3-pyridin-2-yltriazolo[1,5-a]pyridine has a molecular weight of 196.21 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-yltriazolo[1,5-a]pyridine is sourced from PubChem (CID 10899554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).