C14H17F2N3O2 — CID 108996222
1-(4-acetylpiperazin-1-yl)-2-(3,4-difluoroanilino)ethanone (PubChem CID 108996222) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 1-(4-acetylpiperazin-1-yl)-2-(3,4-difluoroanilino)ethanone.
| Compound Name | 1-(4-acetylpiperazin-1-yl)-2-(3,4-difluoroanilino)ethanone |
|---|---|
| PubChem CID | 108996222 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(4-acetylpiperazin-1-yl)-2-(3,4-difluoroanilino)ethanone |
| SMILES | CC(=O)N1CCN(C(=O)CNc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-10(20)18-4-6-19(7-5-18)14(21)9-17-11-2-3-12(15)13(16)8-11/h2-3,8,17H,4-7,9H2,1H3 |
| InChIKey | LMRJERIXMJNWIY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |