C11H16N2O4S — CID 108996316
2-[(1,1-dioxothiolan-3-yl)amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 108996316) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 108996316 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC1CCS(=O)(=O)C1)NCc1ccco1 |
| InChI | InChI=1S/C11H16N2O4S/c14-11(13-6-10-2-1-4-17-10)7-12-9-3-5-18(15,16)8-9/h1-2,4,9,12H,3,5-8H2,(H,13,14) |
| InChIKey | GZMREDWGQLZWLJ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |