About (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol
(1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol (PubChem CID 10899632) has the molecular formula C10H10F2O2
and a molecular weight of 200.18 g/mol. Its IUPAC name is (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol |
| PubChem CID | 10899632 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol |
| SMILES | C[C@H](O)[C@]1(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C10H10F2O2/c1-6(13)10(5-14-10)8-3-2-7(11)4-9(8)12/h2-4,6,13H,5H2,1H3/t6-,10-/m0/s1 |
| InChIKey | HUEOYXUALXBOSZ-WKEGUHRASA-N |
| XLogP | 1.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol?
The IUPAC name of (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol (CID 10899632) is (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol.
What is the SMILES notation for (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol?
The canonical SMILES for (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol is C[C@H](O)[C@]1(c2ccc(F)cc2F)CO1.
What is the InChIKey of (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol?
The InChIKey is HUEOYXUALXBOSZ-WKEGUHRASA-N. The full InChI is InChI=1S/C10H10F2O2/c1-6(13)10(5-14-10)8-3-2-7(11)4-9(8)12/h2-4,6,13H,5H2,1H3/t6-,10-/m0/s1.
What are the key properties of (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol?
(1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol has a molecular weight of 200.18 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2S)-2-(2,4-difluorophenyl)oxiran-2-yl]ethanol is sourced from PubChem (CID 10899632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).