About 2-bromo-4-methoxyaniline
2-bromo-4-methoxyaniline (PubChem CID 10899671) has the molecular formula C7H8BrNO
and a molecular weight of 202.05 g/mol. Its IUPAC name is 2-bromo-4-methoxyaniline.
Molecular Properties
| Compound Name | 2-bromo-4-methoxyaniline |
| PubChem CID | 10899671 |
| Molecular Formula | C7H8BrNO |
| Molecular Weight | 202.05 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | 2-bromo-4-methoxyaniline |
| SMILES | COc1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C7H8BrNO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3 |
| InChIKey | YBAGMTVKDRIMTB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methoxyaniline?
The IUPAC name of 2-bromo-4-methoxyaniline (CID 10899671) is 2-bromo-4-methoxyaniline.
What is the SMILES notation for 2-bromo-4-methoxyaniline?
The canonical SMILES for 2-bromo-4-methoxyaniline is COc1ccc(N)c(Br)c1.
What is the InChIKey of 2-bromo-4-methoxyaniline?
The InChIKey is YBAGMTVKDRIMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,9H2,1H3.
What are the key properties of 2-bromo-4-methoxyaniline?
2-bromo-4-methoxyaniline has a molecular weight of 202.05 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methoxyaniline is sourced from PubChem (CID 10899671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).