C17H17F3N2O — CID 108996969
N-[(3-methylphenyl)methyl]-2-[4-(trifluoromethyl)anilino]acetamide (PubChem CID 108996969) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-2-[4-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(3-methylphenyl)methyl]-2-[4-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 108996969 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-2-[4-(trifluoromethyl)anilino]acetamide |
| SMILES | Cc1cccc(CNC(=O)CNc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H17F3N2O/c1-12-3-2-4-13(9-12)10-22-16(23)11-21-15-7-5-14(6-8-15)17(18,19)20/h2-9,21H,10-11H2,1H3,(H,22,23) |
| InChIKey | ATHKSLIULYGXED-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |