C13H21NO — CID 10899801
(7aR,10aS,10bS)-2-methyl-4,6,7,7a,8,9,10,10b-octahydro-3H-cyclopenta[a]quinolizin-10a-ol (PubChem CID 10899801) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (7aR,10aS,10bS)-2-methyl-4,6,7,7a,8,9,10,10b-octahydro-3H-cyclopenta[a]quinolizin-10a-ol.
| Compound Name | (7aR,10aS,10bS)-2-methyl-4,6,7,7a,8,9,10,10b-octahydro-3H-cyclopenta[a]quinolizin-10a-ol |
|---|---|
| PubChem CID | 10899801 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (7aR,10aS,10bS)-2-methyl-4,6,7,7a,8,9,10,10b-octahydro-3H-cyclopenta[a]quinolizin-10a-ol |
| SMILES | CC1=C[C@@H]2N(CC1)CC[C@H]1CCC[C@]12O |
| InChI | InChI=1S/C13H21NO/c1-10-4-7-14-8-5-11-3-2-6-13(11,15)12(14)9-10/h9,11-12,15H,2-8H2,1H3/t11-,12+,13+/m1/s1 |
| InChIKey | CGQMIDLUNNZGQE-AGIUHOORSA-N |
| XLogP | 1.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|