C16H23ClN2O — CID 108998036
N-[(2-chlorophenyl)methyl]-2-(2-ethylpiperidin-1-yl)acetamide (PubChem CID 108998036) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(2-ethylpiperidin-1-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(2-ethylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 108998036 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(2-ethylpiperidin-1-yl)acetamide |
| SMILES | CCC1CCCCN1CC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O/c1-2-14-8-5-6-10-19(14)12-16(20)18-11-13-7-3-4-9-15(13)17/h3-4,7,9,14H,2,5-6,8,10-12H2,1H3,(H,18,20) |
| InChIKey | RDSPSONXHOCGOV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |