About 8-nitro-1H-3,1-benzoxazine-2,4-dione
8-nitro-1H-3,1-benzoxazine-2,4-dione (PubChem CID 10899806) has the molecular formula C8H4N2O5
and a molecular weight of 208.13 g/mol. Its IUPAC name is 8-nitro-1H-3,1-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 8-nitro-1H-3,1-benzoxazine-2,4-dione |
| PubChem CID | 10899806 |
| Molecular Formula | C8H4N2O5 |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 8-nitro-1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1[nH]c2c([N+](=O)[O-])cccc2c(=O)o1 |
| InChI | InChI=1S/C8H4N2O5/c11-7-4-2-1-3-5(10(13)14)6(4)9-8(12)15-7/h1-3H,(H,9,12) |
| InChIKey | XKFUPFXKLACMEG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-nitro-1H-3,1-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-nitro-1H-3,1-benzoxazine-2,4-dione?
The IUPAC name of 8-nitro-1H-3,1-benzoxazine-2,4-dione (CID 10899806) is 8-nitro-1H-3,1-benzoxazine-2,4-dione.
What is the SMILES notation for 8-nitro-1H-3,1-benzoxazine-2,4-dione?
The canonical SMILES for 8-nitro-1H-3,1-benzoxazine-2,4-dione is O=c1[nH]c2c([N+](=O)[O-])cccc2c(=O)o1.
What is the InChIKey of 8-nitro-1H-3,1-benzoxazine-2,4-dione?
The InChIKey is XKFUPFXKLACMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O5/c11-7-4-2-1-3-5(10(13)14)6(4)9-8(12)15-7/h1-3H,(H,9,12).
What are the key properties of 8-nitro-1H-3,1-benzoxazine-2,4-dione?
8-nitro-1H-3,1-benzoxazine-2,4-dione has a molecular weight of 208.13 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-nitro-1H-3,1-benzoxazine-2,4-dione is sourced from PubChem (CID 10899806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).