About 4-(benzenesulfonyl)-2,3-dihydrofuran
4-(benzenesulfonyl)-2,3-dihydrofuran (PubChem CID 10899873) has the molecular formula C10H10O3S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-(benzenesulfonyl)-2,3-dihydrofuran |
| PubChem CID | 10899873 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-(benzenesulfonyl)-2,3-dihydrofuran |
| SMILES | O=S(=O)(C1=COCC1)c1ccccc1 |
| InChI | InChI=1S/C10H10O3S/c11-14(12,10-6-7-13-8-10)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | HCVLBQBVSZKCPR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(benzenesulfonyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonyl)-2,3-dihydrofuran?
The IUPAC name of 4-(benzenesulfonyl)-2,3-dihydrofuran (CID 10899873) is 4-(benzenesulfonyl)-2,3-dihydrofuran.
What is the SMILES notation for 4-(benzenesulfonyl)-2,3-dihydrofuran?
The canonical SMILES for 4-(benzenesulfonyl)-2,3-dihydrofuran is O=S(=O)(C1=COCC1)c1ccccc1.
What is the InChIKey of 4-(benzenesulfonyl)-2,3-dihydrofuran?
The InChIKey is HCVLBQBVSZKCPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3S/c11-14(12,10-6-7-13-8-10)9-4-2-1-3-5-9/h1-5,8H,6-7H2.
What are the key properties of 4-(benzenesulfonyl)-2,3-dihydrofuran?
4-(benzenesulfonyl)-2,3-dihydrofuran has a molecular weight of 210.25 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonyl)-2,3-dihydrofuran is sourced from PubChem (CID 10899873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).