About (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol
(6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol (PubChem CID 10899874) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol.
Molecular Properties
| Compound Name | (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol |
| PubChem CID | 10899874 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol |
| SMILES | O[C@H]1CC=CC[C@@]12CCCC21OCCO1 |
| InChI | InChI=1S/C12H18O3/c13-10-4-1-2-5-11(10)6-3-7-12(11)14-8-9-15-12/h1-2,10,13H,3-9H2/t10-,11+/m0/s1 |
| InChIKey | BWTNIVMRVPAKLY-WDEREUQCSA-N |
| XLogP | 1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol?
The IUPAC name of (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol (CID 10899874) is (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol.
What is the SMILES notation for (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol?
The canonical SMILES for (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol is O[C@H]1CC=CC[C@@]12CCCC21OCCO1.
What is the InChIKey of (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol?
The InChIKey is BWTNIVMRVPAKLY-WDEREUQCSA-N. The full InChI is InChI=1S/C12H18O3/c13-10-4-1-2-5-11(10)6-3-7-12(11)14-8-9-15-12/h1-2,10,13H,3-9H2/t10-,11+/m0/s1.
What are the key properties of (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol?
(6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol has a molecular weight of 210.27 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7S)-1,4-dioxadispiro[4.0.56.35]tetradec-9-en-7-ol is sourced from PubChem (CID 10899874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).