4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid

C6H4F3NO2S — CID 10899900

IUPAC4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(F)(F)F)sc1C(=O)O
InChIInChI=1S/C6H4F3NO2S/c1-2-3(4(11)12)13-5(10-2)6(7,8)9/h1H3,(H,11,12)
InChIKeyDMKDYSIOZORCEB-UHFFFAOYSA-N
MW211.16 g/mol
LogP2.17
Rot. Bonds1

About 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid

4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 10899900) has the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. Its IUPAC name is 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
PubChem CID10899900
Molecular FormulaC6H4F3NO2S
Molecular Weight211.16 g/mol
Exact Mass210.99
IUPAC Name4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(F)(F)F)sc1C(=O)O
InChIInChI=1S/C6H4F3NO2S/c1-2-3(4(11)12)13-5(10-2)6(7,8)9/h1H3,(H,11,12)
InChIKeyDMKDYSIOZORCEB-UHFFFAOYSA-N
XLogP2.17
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.16
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CID 10899900) is 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is Cc1nc(C(F)(F)F)sc1C(=O)O.
What is the InChIKey of 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is DMKDYSIOZORCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO2S/c1-2-3(4(11)12)13-5(10-2)6(7,8)9/h1H3,(H,11,12).
What are the key properties of 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 211.16 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 10899900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).