About triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane
triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane (PubChem CID 10899948) has the molecular formula C12H24OSi
and a molecular weight of 212.41 g/mol. Its IUPAC name is triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane |
| PubChem CID | 10899948 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane |
| SMILES | C/C=C(/C=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C12H24OSi/c1-6-11-12(7-2)13-14(8-3,9-4)10-5/h6-7,11H,8-10H2,1-5H3/b11-6+,12-7- |
| InChIKey | HHQGXFKBKVNRHE-CZIBKUHYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane?
The IUPAC name of triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane (CID 10899948) is triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane.
What is the SMILES notation for triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane?
The canonical SMILES for triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane is C/C=C(/C=C/C)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane?
The InChIKey is HHQGXFKBKVNRHE-CZIBKUHYSA-N. The full InChI is InChI=1S/C12H24OSi/c1-6-11-12(7-2)13-14(8-3,9-4)10-5/h6-7,11H,8-10H2,1-5H3/b11-6+,12-7-.
What are the key properties of triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane?
triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane has a molecular weight of 212.41 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(2Z,4E)-hexa-2,4-dien-3-yl]oxysilane is sourced from PubChem (CID 10899948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).