About methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate
methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate (PubChem CID 10899983) has the molecular formula C7H10N4O4
and a molecular weight of 214.18 g/mol. Its IUPAC name is methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate |
| PubChem CID | 10899983 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H](N=[N+]=[N-])[C@H]1CO |
| InChI | InChI=1S/C7H10N4O4/c1-15-5(13)2-11-4(3-12)6(7(11)14)9-10-8/h4,6,12H,2-3H2,1H3/t4-,6+/m1/s1 |
| InChIKey | HMNUCQNLZLPEOC-XINAWCOVSA-N |
| XLogP | -0.96 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate?
The IUPAC name of methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate (CID 10899983) is methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate.
What is the SMILES notation for methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate?
The canonical SMILES for methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate is COC(=O)CN1C(=O)[C@@H](N=[N+]=[N-])[C@H]1CO.
What is the InChIKey of methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate?
The InChIKey is HMNUCQNLZLPEOC-XINAWCOVSA-N. The full InChI is InChI=1S/C7H10N4O4/c1-15-5(13)2-11-4(3-12)6(7(11)14)9-10-8/h4,6,12H,2-3H2,1H3/t4-,6+/m1/s1.
What are the key properties of methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate?
methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate has a molecular weight of 214.18 g/mol, XLogP of -0.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,3S)-3-azido-2-(hydroxymethyl)-4-oxoazetidin-1-yl]acetate is sourced from PubChem (CID 10899983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).