C18H22N2O3 — CID 109001073
2-(3-methoxyanilino)-N-[2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 109001073) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(3-methoxyanilino)-N-[2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3-methoxyanilino)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 109001073 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-(3-methoxyanilino)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc(CCNC(=O)CNc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-22-16-7-3-5-14(11-16)9-10-19-18(21)13-20-15-6-4-8-17(12-15)23-2/h3-8,11-12,20H,9-10,13H2,1-2H3,(H,19,21) |
| InChIKey | GJPLAGXNHCEQKD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |