About S-phenyl cyclohexanecarbothioate
S-phenyl cyclohexanecarbothioate (PubChem CID 10900146) has the molecular formula C13H16OS
and a molecular weight of 220.34 g/mol. Its IUPAC name is S-phenyl cyclohexanecarbothioate.
Molecular Properties
| Compound Name | S-phenyl cyclohexanecarbothioate |
| PubChem CID | 10900146 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | S-phenyl cyclohexanecarbothioate |
| SMILES | O=C(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C13H16OS/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2 |
| InChIKey | YDDAIPNDFFZIAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl cyclohexanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl cyclohexanecarbothioate?
The IUPAC name of S-phenyl cyclohexanecarbothioate (CID 10900146) is S-phenyl cyclohexanecarbothioate.
What is the SMILES notation for S-phenyl cyclohexanecarbothioate?
The canonical SMILES for S-phenyl cyclohexanecarbothioate is O=C(Sc1ccccc1)C1CCCCC1.
What is the InChIKey of S-phenyl cyclohexanecarbothioate?
The InChIKey is YDDAIPNDFFZIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16OS/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2.
What are the key properties of S-phenyl cyclohexanecarbothioate?
S-phenyl cyclohexanecarbothioate has a molecular weight of 220.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl cyclohexanecarbothioate is sourced from PubChem (CID 10900146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).