C20H27N3O — CID 109001538
2-(4-tert-butylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 109001538) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-(4-tert-butylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(4-tert-butylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 109001538 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2-(4-tert-butylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | CN(CCc1ccncc1)C(=O)CNc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O/c1-20(2,3)17-5-7-18(8-6-17)22-15-19(24)23(4)14-11-16-9-12-21-13-10-16/h5-10,12-13,22H,11,14-15H2,1-4H3 |
| InChIKey | YAWBWXSOPVAISE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |