C16H15N — CID 10900179
1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethanamine (PubChem CID 10900179) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethanamine.
| Compound Name | 1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethanamine |
|---|---|
| PubChem CID | 10900179 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenylmethanamine |
| SMILES | NCC12CC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C16H15N/c17-10-16-9-13(11-5-1-3-7-14(11)16)12-6-2-4-8-15(12)16/h1-8,13H,9-10,17H2 |
| InChIKey | IZUFWQBEJCIXMX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |