C18H19Cl2N3O — CID 109002179
2-(2,3-dichloroanilino)-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 109002179) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 2-(2,3-dichloroanilino)-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2,3-dichloroanilino)-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 109002179 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(2,3-dichloroanilino)-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CNc1cccc(Cl)c1Cl)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-15-7-4-8-16(18(15)20)21-13-17(24)23-11-9-22(10-12-23)14-5-2-1-3-6-14/h1-8,21H,9-13H2 |
| InChIKey | NTLVROVIHYSYHQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |