C13H20O3 — CID 10900256
(3E,5E)-1-(2,2-dimethyl-1,3-dioxan-4-yl)hepta-3,5-dien-2-one (PubChem CID 10900256) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3E,5E)-1-(2,2-dimethyl-1,3-dioxan-4-yl)hepta-3,5-dien-2-one.
| Compound Name | (3E,5E)-1-(2,2-dimethyl-1,3-dioxan-4-yl)hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 10900256 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3E,5E)-1-(2,2-dimethyl-1,3-dioxan-4-yl)hepta-3,5-dien-2-one |
| SMILES | C/C=C/C=C/C(=O)CC1CCOC(C)(C)O1 |
| InChI | InChI=1S/C13H20O3/c1-4-5-6-7-11(14)10-12-8-9-15-13(2,3)16-12/h4-7,12H,8-10H2,1-3H3/b5-4+,7-6+ |
| InChIKey | ADBFNEHLTHKKER-YTXTXJHMSA-N |
| XLogP | 2.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|