C18H22N2O3 — CID 109003065
2-[(3,4-dimethoxyphenyl)methylamino]-N-methyl-N-phenylacetamide (PubChem CID 109003065) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylamino]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylamino]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 109003065 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylamino]-N-methyl-N-phenylacetamide |
| SMILES | COc1ccc(CNCC(=O)N(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H22N2O3/c1-20(15-7-5-4-6-8-15)18(21)13-19-12-14-9-10-16(22-2)17(11-14)23-3/h4-11,19H,12-13H2,1-3H3 |
| InChIKey | JQBNHVIEVIBPJJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |