C16H23N3O4 — CID 109003881
ethyl 4-[2-(2-methoxyanilino)acetyl]piperazine-1-carboxylate (PubChem CID 109003881) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 4-[2-(2-methoxyanilino)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-methoxyanilino)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109003881 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl 4-[2-(2-methoxyanilino)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CNc2ccccc2OC)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-3-23-16(21)19-10-8-18(9-11-19)15(20)12-17-13-6-4-5-7-14(13)22-2/h4-7,17H,3,8-12H2,1-2H3 |
| InChIKey | VKDUDKCJAWVPQV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |