C20H25N3O — CID 109004018
2-(3-methylanilino)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 109004018) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(3-methylanilino)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methylanilino)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109004018 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-(3-methylanilino)-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(NCC(=O)N2CCN(c3cccc(C)c3)CC2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-16-5-3-7-18(13-16)21-15-20(24)23-11-9-22(10-12-23)19-8-4-6-17(2)14-19/h3-8,13-14,21H,9-12,15H2,1-2H3 |
| InChIKey | NRSBOIJRXVFBQZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |