C23H31N3O2 — CID 109004142
1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2-methyl-6-propan-2-ylanilino)ethanone (PubChem CID 109004142) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2-methyl-6-propan-2-ylanilino)ethanone.
| Compound Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2-methyl-6-propan-2-ylanilino)ethanone |
|---|---|
| PubChem CID | 109004142 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-(2-methyl-6-propan-2-ylanilino)ethanone |
| SMILES | COc1ccccc1N1CCN(C(=O)CNc2c(C)cccc2C(C)C)CC1 |
| InChI | InChI=1S/C23H31N3O2/c1-17(2)19-9-7-8-18(3)23(19)24-16-22(27)26-14-12-25(13-15-26)20-10-5-6-11-21(20)28-4/h5-11,17,24H,12-16H2,1-4H3 |
| InChIKey | KZJOELSGFXTBIS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |