C20H24FN3O — CID 109004433
2-(3,5-dimethylanilino)-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 109004433) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-(3,5-dimethylanilino)-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3,5-dimethylanilino)-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109004433 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-(3,5-dimethylanilino)-1-[4-(2-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(C)cc(NCC(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C20H24FN3O/c1-15-11-16(2)13-17(12-15)22-14-20(25)24-9-7-23(8-10-24)19-6-4-3-5-18(19)21/h3-6,11-13,22H,7-10,14H2,1-2H3 |
| InChIKey | MDARAPLVZJJXDP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |